C16H15BrN4 — CID 64587901
4-N-[(4-bromophenyl)methyl]-4-N-methylquinazoline-4,6-diamine (PubChem CID 64587901) has the molecular formula C16H15BrN4 and a molecular weight of 343.23 g/mol. Its IUPAC name is 4-N-[(4-bromophenyl)methyl]-4-N-methylquinazoline-4,6-diamine.
| Compound Name | 4-N-[(4-bromophenyl)methyl]-4-N-methylquinazoline-4,6-diamine |
|---|---|
| PubChem CID | 64587901 |
| Molecular Formula | C16H15BrN4 |
| Molecular Weight | 343.23 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | 4-N-[(4-bromophenyl)methyl]-4-N-methylquinazoline-4,6-diamine |
| SMILES | CN(Cc1ccc(Br)cc1)c1ncnc2ccc(N)cc12 |
| InChI | InChI=1S/C16H15BrN4/c1-21(9-11-2-4-12(17)5-3-11)16-14-8-13(18)6-7-15(14)19-10-20-16/h2-8,10H,9,18H2,1H3 |
| InChIKey | WNWKGRIILQBYPJ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.23 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|