C11H19N5O2S — CID 80898843
N-(1,1-dioxothian-4-yl)-5-ethyl-6-hydrazinylpyrimidin-4-amine (PubChem CID 80898843) has the molecular formula C11H19N5O2S and a molecular weight of 285.37 g/mol. Its IUPAC name is N-(1,1-dioxothian-4-yl)-5-ethyl-6-hydrazinylpyrimidin-4-amine.
| Compound Name | N-(1,1-dioxothian-4-yl)-5-ethyl-6-hydrazinylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80898843 |
| Molecular Formula | C11H19N5O2S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | N-(1,1-dioxothian-4-yl)-5-ethyl-6-hydrazinylpyrimidin-4-amine |
| SMILES | CCc1c(NN)ncnc1NC1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C11H19N5O2S/c1-2-9-10(13-7-14-11(9)16-12)15-8-3-5-19(17,18)6-4-8/h7-8H,2-6,12H2,1H3,(H2,13,14,15,16) |
| InChIKey | XUUUCQIREJVTHZ-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|