C9H13BrN4O2S — CID 114072004
5-bromo-4-N-(1,1-dioxothian-4-yl)pyrimidine-4,6-diamine (PubChem CID 114072004) has the molecular formula C9H13BrN4O2S and a molecular weight of 321.20 g/mol. Its IUPAC name is 5-bromo-4-N-(1,1-dioxothian-4-yl)pyrimidine-4,6-diamine.
| Compound Name | 5-bromo-4-N-(1,1-dioxothian-4-yl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 114072004 |
| Molecular Formula | C9H13BrN4O2S |
| Molecular Weight | 321.20 g/mol |
| Exact Mass | 319.99 |
| IUPAC Name | 5-bromo-4-N-(1,1-dioxothian-4-yl)pyrimidine-4,6-diamine |
| SMILES | Nc1ncnc(NC2CCS(=O)(=O)CC2)c1Br |
| InChI | InChI=1S/C9H13BrN4O2S/c10-7-8(11)12-5-13-9(7)14-6-1-3-17(15,16)4-2-6/h5-6H,1-4H2,(H3,11,12,13,14) |
| InChIKey | OQFVGGCERMEYGA-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.20 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |