C14H15BrN2O2S — CID 106537654
5-bromo-N-(1,1-dioxothian-4-yl)isoquinolin-1-amine (PubChem CID 106537654) has the molecular formula C14H15BrN2O2S and a molecular weight of 355.26 g/mol. Its IUPAC name is 5-bromo-N-(1,1-dioxothian-4-yl)isoquinolin-1-amine.
| Compound Name | 5-bromo-N-(1,1-dioxothian-4-yl)isoquinolin-1-amine |
|---|---|
| PubChem CID | 106537654 |
| Molecular Formula | C14H15BrN2O2S |
| Molecular Weight | 355.26 g/mol |
| Exact Mass | 354.00 |
| IUPAC Name | 5-bromo-N-(1,1-dioxothian-4-yl)isoquinolin-1-amine |
| SMILES | O=S1(=O)CCC(Nc2nccc3c(Br)cccc23)CC1 |
| InChI | InChI=1S/C14H15BrN2O2S/c15-13-3-1-2-12-11(13)4-7-16-14(12)17-10-5-8-20(18,19)9-6-10/h1-4,7,10H,5-6,8-9H2,(H,16,17) |
| InChIKey | ZBBFCPYQXZNOBH-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.26 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |