C14H12BrN3O2 — CID 106538978
3-[(5-bromoisoquinolin-1-yl)amino]piperidine-2,6-dione (PubChem CID 106538978) has the molecular formula C14H12BrN3O2 and a molecular weight of 334.17 g/mol. Its IUPAC name is 3-[(5-bromoisoquinolin-1-yl)amino]piperidine-2,6-dione.
| Compound Name | 3-[(5-bromoisoquinolin-1-yl)amino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 106538978 |
| Molecular Formula | C14H12BrN3O2 |
| Molecular Weight | 334.17 g/mol |
| Exact Mass | 333.01 |
| IUPAC Name | 3-[(5-bromoisoquinolin-1-yl)amino]piperidine-2,6-dione |
| SMILES | O=C1CCC(Nc2nccc3c(Br)cccc23)C(=O)N1 |
| InChI | InChI=1S/C14H12BrN3O2/c15-10-3-1-2-9-8(10)6-7-16-13(9)17-11-4-5-12(19)18-14(11)20/h1-3,6-7,11H,4-5H2,(H,16,17)(H,18,19,20) |
| InChIKey | PYQPDWNJXQPMQE-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.17 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|