C11H10F3N3O2 — CID 66328290
3-[[4-(trifluoromethyl)-2-pyridinyl]amino]piperidine-2,6-dione (PubChem CID 66328290) has the molecular formula C11H10F3N3O2 and a molecular weight of 273.21 g/mol. Its IUPAC name is 3-[[4-(trifluoromethyl)-2-pyridinyl]amino]piperidine-2,6-dione.
| Compound Name | 3-[[4-(trifluoromethyl)-2-pyridinyl]amino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 66328290 |
| Molecular Formula | C11H10F3N3O2 |
| Molecular Weight | 273.21 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | 3-[[4-(trifluoromethyl)-2-pyridinyl]amino]piperidine-2,6-dione |
| SMILES | O=C1CCC(Nc2cc(C(F)(F)F)ccn2)C(=O)N1 |
| InChI | InChI=1S/C11H10F3N3O2/c12-11(13,14)6-3-4-15-8(5-6)16-7-1-2-9(18)17-10(7)19/h3-5,7H,1-2H2,(H,15,16)(H,17,18,19) |
| InChIKey | KNLUTSKSFHPFOP-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.21 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|