C12H13F3N2 — CID 66331048
N-cyclohex-3-en-1-yl-4-(trifluoromethyl)pyridin-2-amine (PubChem CID 66331048) has the molecular formula C12H13F3N2 and a molecular weight of 242.24 g/mol. Its IUPAC name is N-cyclohex-3-en-1-yl-4-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-cyclohex-3-en-1-yl-4-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 66331048 |
| Molecular Formula | C12H13F3N2 |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | N-cyclohex-3-en-1-yl-4-(trifluoromethyl)pyridin-2-amine |
| SMILES | FC(F)(F)c1ccnc(NC2CC=CCC2)c1 |
| InChI | InChI=1S/C12H13F3N2/c13-12(14,15)9-6-7-16-11(8-9)17-10-4-2-1-3-5-10/h1-2,6-8,10H,3-5H2,(H,16,17) |
| InChIKey | UKAXYVWLVXVFJQ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|