C16H23F3N2O — CID 133440410
N-(2-pentan-3-yloxan-4-yl)-4-(trifluoromethyl)pyridin-2-amine (PubChem CID 133440410) has the molecular formula C16H23F3N2O and a molecular weight of 316.37 g/mol. Its IUPAC name is N-(2-pentan-3-yloxan-4-yl)-4-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-(2-pentan-3-yloxan-4-yl)-4-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 133440410 |
| Molecular Formula | C16H23F3N2O |
| Molecular Weight | 316.37 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | N-(2-pentan-3-yloxan-4-yl)-4-(trifluoromethyl)pyridin-2-amine |
| SMILES | CCC(CC)C1CC(Nc2cc(C(F)(F)F)ccn2)CCO1 |
| InChI | InChI=1S/C16H23F3N2O/c1-3-11(4-2)14-10-13(6-8-22-14)21-15-9-12(5-7-20-15)16(17,18)19/h5,7,9,11,13-14H,3-4,6,8,10H2,1-2H3,(H,20,21) |
| InChIKey | YDCWSDMNGNODFR-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.37 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |