C15H25N3O3S — CID 133440405
2-[(2-pentan-3-yloxan-4-yl)amino]pyridine-3-sulfonamide (PubChem CID 133440405) has the molecular formula C15H25N3O3S and a molecular weight of 327.45 g/mol. Its IUPAC name is 2-[(2-pentan-3-yloxan-4-yl)amino]pyridine-3-sulfonamide.
| Compound Name | 2-[(2-pentan-3-yloxan-4-yl)amino]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 133440405 |
| Molecular Formula | C15H25N3O3S |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 2-[(2-pentan-3-yloxan-4-yl)amino]pyridine-3-sulfonamide |
| SMILES | CCC(CC)C1CC(Nc2ncccc2S(N)(=O)=O)CCO1 |
| InChI | InChI=1S/C15H25N3O3S/c1-3-11(4-2)13-10-12(7-9-21-13)18-15-14(22(16,19)20)6-5-8-17-15/h5-6,8,11-13H,3-4,7,9-10H2,1-2H3,(H,17,18)(H2,16,19,20) |
| InChIKey | MKABXGBSTQDQJA-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |