C17H25F2NO3S — CID 133441630
N-[4-(difluoromethylsulfonyl)phenyl]-2-pentan-3-yloxan-4-amine (PubChem CID 133441630) has the molecular formula C17H25F2NO3S and a molecular weight of 361.45 g/mol. Its IUPAC name is N-[4-(difluoromethylsulfonyl)phenyl]-2-pentan-3-yloxan-4-amine.
| Compound Name | N-[4-(difluoromethylsulfonyl)phenyl]-2-pentan-3-yloxan-4-amine |
|---|---|
| PubChem CID | 133441630 |
| Molecular Formula | C17H25F2NO3S |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | N-[4-(difluoromethylsulfonyl)phenyl]-2-pentan-3-yloxan-4-amine |
| SMILES | CCC(CC)C1CC(Nc2ccc(S(=O)(=O)C(F)F)cc2)CCO1 |
| InChI | InChI=1S/C17H25F2NO3S/c1-3-12(4-2)16-11-14(9-10-23-16)20-13-5-7-15(8-6-13)24(21,22)17(18)19/h5-8,12,14,16-17,20H,3-4,9-11H2,1-2H3 |
| InChIKey | AUMTXEXZBANRQZ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |