C19H32N2O3S — CID 133461855
6-tert-butylsulfonyl-N-(2-pentan-3-yloxan-4-yl)pyridin-3-amine (PubChem CID 133461855) has the molecular formula C19H32N2O3S and a molecular weight of 368.54 g/mol. Its IUPAC name is 6-tert-butylsulfonyl-N-(2-pentan-3-yloxan-4-yl)pyridin-3-amine.
| Compound Name | 6-tert-butylsulfonyl-N-(2-pentan-3-yloxan-4-yl)pyridin-3-amine |
|---|---|
| PubChem CID | 133461855 |
| Molecular Formula | C19H32N2O3S |
| Molecular Weight | 368.54 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | 6-tert-butylsulfonyl-N-(2-pentan-3-yloxan-4-yl)pyridin-3-amine |
| SMILES | CCC(CC)C1CC(Nc2ccc(S(=O)(=O)C(C)(C)C)nc2)CCO1 |
| InChI | InChI=1S/C19H32N2O3S/c1-6-14(7-2)17-12-15(10-11-24-17)21-16-8-9-18(20-13-16)25(22,23)19(3,4)5/h8-9,13-15,17,21H,6-7,10-12H2,1-5H3 |
| InChIKey | CIHCVVHGMKWXLC-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.54 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |