C16H27N3O2 — CID 133439346
1-ethyl-3-[(2-pentan-3-yloxan-4-yl)amino]pyrazin-2-one (PubChem CID 133439346) has the molecular formula C16H27N3O2 and a molecular weight of 293.41 g/mol. Its IUPAC name is 1-ethyl-3-[(2-pentan-3-yloxan-4-yl)amino]pyrazin-2-one.
| Compound Name | 1-ethyl-3-[(2-pentan-3-yloxan-4-yl)amino]pyrazin-2-one |
|---|---|
| PubChem CID | 133439346 |
| Molecular Formula | C16H27N3O2 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | 1-ethyl-3-[(2-pentan-3-yloxan-4-yl)amino]pyrazin-2-one |
| SMILES | CCC(CC)C1CC(Nc2nccn(CC)c2=O)CCO1 |
| InChI | InChI=1S/C16H27N3O2/c1-4-12(5-2)14-11-13(7-10-21-14)18-15-16(20)19(6-3)9-8-17-15/h8-9,12-14H,4-7,10-11H2,1-3H3,(H,17,18) |
| InChIKey | NMQLLBYCKJKSBW-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |