C13H18F3N3 — CID 66329078
1-N-[4-(trifluoromethyl)-2-pyridinyl]cycloheptane-1,2-diamine (PubChem CID 66329078) has the molecular formula C13H18F3N3 and a molecular weight of 273.30 g/mol. Its IUPAC name is 1-N-[4-(trifluoromethyl)-2-pyridinyl]cycloheptane-1,2-diamine.
| Compound Name | 1-N-[4-(trifluoromethyl)-2-pyridinyl]cycloheptane-1,2-diamine |
|---|---|
| PubChem CID | 66329078 |
| Molecular Formula | C13H18F3N3 |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 1-N-[4-(trifluoromethyl)-2-pyridinyl]cycloheptane-1,2-diamine |
| SMILES | NC1CCCCCC1Nc1cc(C(F)(F)F)ccn1 |
| InChI | InChI=1S/C13H18F3N3/c14-13(15,16)9-6-7-18-12(8-9)19-11-5-3-1-2-4-10(11)17/h6-8,10-11H,1-5,17H2,(H,18,19) |
| InChIKey | INZLCSAOHTUHPE-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |