C12H16F3N3 — CID 107173809
N-[4-(trifluoromethyl)-2-pyridinyl]azepan-4-amine (PubChem CID 107173809) has the molecular formula C12H16F3N3 and a molecular weight of 259.27 g/mol. Its IUPAC name is N-[4-(trifluoromethyl)-2-pyridinyl]azepan-4-amine.
| Compound Name | N-[4-(trifluoromethyl)-2-pyridinyl]azepan-4-amine |
|---|---|
| PubChem CID | 107173809 |
| Molecular Formula | C12H16F3N3 |
| Molecular Weight | 259.27 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | N-[4-(trifluoromethyl)-2-pyridinyl]azepan-4-amine |
| SMILES | FC(F)(F)c1ccnc(NC2CCCNCC2)c1 |
| InChI | InChI=1S/C12H16F3N3/c13-12(14,15)9-3-7-17-11(8-9)18-10-2-1-5-16-6-4-10/h3,7-8,10,16H,1-2,4-6H2,(H,17,18) |
| InChIKey | ACRLDNXYMUEQSQ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.27 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |