C11H15BrN2O2S — CID 105366729
3-bromo-N-(1,1-dioxothian-4-yl)-5-methylpyridin-2-amine (PubChem CID 105366729) has the molecular formula C11H15BrN2O2S and a molecular weight of 319.22 g/mol. Its IUPAC name is 3-bromo-N-(1,1-dioxothian-4-yl)-5-methylpyridin-2-amine.
| Compound Name | 3-bromo-N-(1,1-dioxothian-4-yl)-5-methylpyridin-2-amine |
|---|---|
| PubChem CID | 105366729 |
| Molecular Formula | C11H15BrN2O2S |
| Molecular Weight | 319.22 g/mol |
| Exact Mass | 318.00 |
| IUPAC Name | 3-bromo-N-(1,1-dioxothian-4-yl)-5-methylpyridin-2-amine |
| SMILES | Cc1cnc(NC2CCS(=O)(=O)CC2)c(Br)c1 |
| InChI | InChI=1S/C11H15BrN2O2S/c1-8-6-10(12)11(13-7-8)14-9-2-4-17(15,16)5-3-9/h6-7,9H,2-5H2,1H3,(H,13,14) |
| InChIKey | MZRMLVHSLCPHJC-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.22 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |