About 3-bromo-N-(1,1-dioxothian-4-yl)-5-methylpyridin-2-amine
3-bromo-N-(1,1-dioxothian-4-yl)-5-methylpyridin-2-amine (PubChem CID 105366729) has the molecular formula C11H15BrN2O2S
and a molecular weight of 319.22 g/mol. Its IUPAC name is 3-bromo-N-(1,1-dioxothian-4-yl)-5-methylpyridin-2-amine.
Molecular Properties
| Compound Name | 3-bromo-N-(1,1-dioxothian-4-yl)-5-methylpyridin-2-amine |
| PubChem CID | 105366729 |
| Molecular Formula | C11H15BrN2O2S |
| Molecular Weight | 319.22 g/mol |
| Exact Mass | 318.00 |
| IUPAC Name | 3-bromo-N-(1,1-dioxothian-4-yl)-5-methylpyridin-2-amine |
| SMILES | Cc1cnc(NC2CCS(=O)(=O)CC2)c(Br)c1 |
| InChI | InChI=1S/C11H15BrN2O2S/c1-8-6-10(12)11(13-7-8)14-9-2-4-17(15,16)5-3-9/h6-7,9H,2-5H2,1H3,(H,13,14) |
| InChIKey | MZRMLVHSLCPHJC-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.22 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-bromo-N-(1,1-dioxothian-4-yl)-5-methylpyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-N-(1,1-dioxothian-4-yl)-5-methylpyridin-2-amine?
The IUPAC name of 3-bromo-N-(1,1-dioxothian-4-yl)-5-methylpyridin-2-amine (CID 105366729) is 3-bromo-N-(1,1-dioxothian-4-yl)-5-methylpyridin-2-amine.
What is the SMILES notation for 3-bromo-N-(1,1-dioxothian-4-yl)-5-methylpyridin-2-amine?
The canonical SMILES for 3-bromo-N-(1,1-dioxothian-4-yl)-5-methylpyridin-2-amine is Cc1cnc(NC2CCS(=O)(=O)CC2)c(Br)c1.
What is the InChIKey of 3-bromo-N-(1,1-dioxothian-4-yl)-5-methylpyridin-2-amine?
The InChIKey is MZRMLVHSLCPHJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15BrN2O2S/c1-8-6-10(12)11(13-7-8)14-9-2-4-17(15,16)5-3-9/h6-7,9H,2-5H2,1H3,(H,13,14).
What are the key properties of 3-bromo-N-(1,1-dioxothian-4-yl)-5-methylpyridin-2-amine?
3-bromo-N-(1,1-dioxothian-4-yl)-5-methylpyridin-2-amine has a molecular weight of 319.22 g/mol, XLogP of 2.14, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-N-(1,1-dioxothian-4-yl)-5-methylpyridin-2-amine is sourced from PubChem (CID 105366729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).