C9H10BrClN2O2S — CID 103579980
5-bromo-3-chloro-N-(1,1-dioxothiolan-3-yl)pyridin-2-amine (PubChem CID 103579980) has the molecular formula C9H10BrClN2O2S and a molecular weight of 325.62 g/mol. Its IUPAC name is 5-bromo-3-chloro-N-(1,1-dioxothiolan-3-yl)pyridin-2-amine.
| Compound Name | 5-bromo-3-chloro-N-(1,1-dioxothiolan-3-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 103579980 |
| Molecular Formula | C9H10BrClN2O2S |
| Molecular Weight | 325.62 g/mol |
| Exact Mass | 323.93 |
| IUPAC Name | 5-bromo-3-chloro-N-(1,1-dioxothiolan-3-yl)pyridin-2-amine |
| SMILES | O=S1(=O)CCC(Nc2ncc(Br)cc2Cl)C1 |
| InChI | InChI=1S/C9H10BrClN2O2S/c10-6-3-8(11)9(12-4-6)13-7-1-2-16(14,15)5-7/h3-4,7H,1-2,5H2,(H,12,13) |
| InChIKey | TWBFVFZGRCWSAL-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.62 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |