C9H11BrN2O2S — CID 61373712
3-bromo-N-(1,1-dioxothiolan-3-yl)pyridin-2-amine (PubChem CID 61373712) has the molecular formula C9H11BrN2O2S and a molecular weight of 291.17 g/mol. Its IUPAC name is 3-bromo-N-(1,1-dioxothiolan-3-yl)pyridin-2-amine.
| Compound Name | 3-bromo-N-(1,1-dioxothiolan-3-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 61373712 |
| Molecular Formula | C9H11BrN2O2S |
| Molecular Weight | 291.17 g/mol |
| Exact Mass | 289.97 |
| IUPAC Name | 3-bromo-N-(1,1-dioxothiolan-3-yl)pyridin-2-amine |
| SMILES | O=S1(=O)CCC(Nc2ncccc2Br)C1 |
| InChI | InChI=1S/C9H11BrN2O2S/c10-8-2-1-4-11-9(8)12-7-3-5-15(13,14)6-7/h1-2,4,7H,3,5-6H2,(H,11,12) |
| InChIKey | OGNNBKQXGCSNNE-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.17 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |