C11H11BrN2O2S — CID 114880486
2-bromo-6-[(1,1-dioxothiolan-3-yl)amino]benzonitrile (PubChem CID 114880486) has the molecular formula C11H11BrN2O2S and a molecular weight of 315.19 g/mol. Its IUPAC name is 2-bromo-6-[(1,1-dioxothiolan-3-yl)amino]benzonitrile.
| Compound Name | 2-bromo-6-[(1,1-dioxothiolan-3-yl)amino]benzonitrile |
|---|---|
| PubChem CID | 114880486 |
| Molecular Formula | C11H11BrN2O2S |
| Molecular Weight | 315.19 g/mol |
| Exact Mass | 313.97 |
| IUPAC Name | 2-bromo-6-[(1,1-dioxothiolan-3-yl)amino]benzonitrile |
| SMILES | N#Cc1c(Br)cccc1NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H11BrN2O2S/c12-10-2-1-3-11(9(10)6-13)14-8-4-5-17(15,16)7-8/h1-3,8,14H,4-5,7H2 |
| InChIKey | LXOPXBUHVQKRNQ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.19 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |