C12H15BrN2O3S — CID 124606142
1-(3-bromo-2-methylphenyl)-3-[(3S)-1,1-dioxothiolan-3-yl]urea (PubChem CID 124606142) has the molecular formula C12H15BrN2O3S and a molecular weight of 347.23 g/mol. Its IUPAC name is 1-(3-bromo-2-methylphenyl)-3-[(3S)-1,1-dioxothiolan-3-yl]urea.
| Compound Name | 1-(3-bromo-2-methylphenyl)-3-[(3S)-1,1-dioxothiolan-3-yl]urea |
|---|---|
| PubChem CID | 124606142 |
| Molecular Formula | C12H15BrN2O3S |
| Molecular Weight | 347.23 g/mol |
| Exact Mass | 346.00 |
| IUPAC Name | 1-(3-bromo-2-methylphenyl)-3-[(3S)-1,1-dioxothiolan-3-yl]urea |
| SMILES | Cc1c(Br)cccc1NC(=O)N[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H15BrN2O3S/c1-8-10(13)3-2-4-11(8)15-12(16)14-9-5-6-19(17,18)7-9/h2-4,9H,5-7H2,1H3,(H2,14,15,16)/t9-/m0/s1 |
| InChIKey | QMSIYWXIVRNOTM-VIFPVBQESA-N |
| XLogP | 2.07 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.23 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |