C11H12Cl2N2O3S — CID 110706193
1-(2,3-dichlorophenyl)-3-(1,1-dioxothiolan-3-yl)urea (PubChem CID 110706193) has the molecular formula C11H12Cl2N2O3S and a molecular weight of 323.20 g/mol. Its IUPAC name is 1-(2,3-dichlorophenyl)-3-(1,1-dioxothiolan-3-yl)urea.
| Compound Name | 1-(2,3-dichlorophenyl)-3-(1,1-dioxothiolan-3-yl)urea |
|---|---|
| PubChem CID | 110706193 |
| Molecular Formula | C11H12Cl2N2O3S |
| Molecular Weight | 323.20 g/mol |
| Exact Mass | 321.99 |
| IUPAC Name | 1-(2,3-dichlorophenyl)-3-(1,1-dioxothiolan-3-yl)urea |
| SMILES | O=C(Nc1cccc(Cl)c1Cl)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H12Cl2N2O3S/c12-8-2-1-3-9(10(8)13)15-11(16)14-7-4-5-19(17,18)6-7/h1-3,7H,4-6H2,(H2,14,15,16) |
| InChIKey | XGNCJVYKHPFCKB-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.20 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |