C13H15Cl2NO3S — CID 95282350
(2S)-2-(2,6-dichlorophenyl)-N-[(3S)-1,1-dioxothiolan-3-yl]propanamide (PubChem CID 95282350) has the molecular formula C13H15Cl2NO3S and a molecular weight of 336.24 g/mol. Its IUPAC name is (2S)-2-(2,6-dichlorophenyl)-N-[(3S)-1,1-dioxothiolan-3-yl]propanamide.
| Compound Name | (2S)-2-(2,6-dichlorophenyl)-N-[(3S)-1,1-dioxothiolan-3-yl]propanamide |
|---|---|
| PubChem CID | 95282350 |
| Molecular Formula | C13H15Cl2NO3S |
| Molecular Weight | 336.24 g/mol |
| Exact Mass | 335.01 |
| IUPAC Name | (2S)-2-(2,6-dichlorophenyl)-N-[(3S)-1,1-dioxothiolan-3-yl]propanamide |
| SMILES | C[C@H](C(=O)N[C@H]1CCS(=O)(=O)C1)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C13H15Cl2NO3S/c1-8(12-10(14)3-2-4-11(12)15)13(17)16-9-5-6-20(18,19)7-9/h2-4,8-9H,5-7H2,1H3,(H,16,17)/t8-,9-/m0/s1 |
| InChIKey | XOSKDKSCZBXRMT-IUCAKERBSA-N |
| XLogP | 2.40 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.24 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |