C7H14N2O3S — CID 78972072
(2R)-2-amino-N-(1,1-dioxothiolan-3-yl)propanamide (PubChem CID 78972072) has the molecular formula C7H14N2O3S and a molecular weight of 206.27 g/mol. Its IUPAC name is (2R)-2-amino-N-(1,1-dioxothiolan-3-yl)propanamide.
| Compound Name | (2R)-2-amino-N-(1,1-dioxothiolan-3-yl)propanamide |
|---|---|
| PubChem CID | 78972072 |
| Molecular Formula | C7H14N2O3S |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | (2R)-2-amino-N-(1,1-dioxothiolan-3-yl)propanamide |
| SMILES | C[C@@H](N)C(=O)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C7H14N2O3S/c1-5(8)7(10)9-6-2-3-13(11,12)4-6/h5-6H,2-4,8H2,1H3,(H,9,10)/t5-,6?/m1/s1 |
| InChIKey | WZROLUKPSZECPL-LWOQYNTDSA-N |
| XLogP | -1.36 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |