C9H17NO2S — CID 170117431
N-(3-methylbut-1-en-2-yl)-1,1-dioxothiolan-3-amine (PubChem CID 170117431) has the molecular formula C9H17NO2S and a molecular weight of 203.31 g/mol. Its IUPAC name is N-(3-methylbut-1-en-2-yl)-1,1-dioxothiolan-3-amine.
| Compound Name | N-(3-methylbut-1-en-2-yl)-1,1-dioxothiolan-3-amine |
|---|---|
| PubChem CID | 170117431 |
| Molecular Formula | C9H17NO2S |
| Molecular Weight | 203.31 g/mol |
| Exact Mass | 203.10 |
| IUPAC Name | N-(3-methylbut-1-en-2-yl)-1,1-dioxothiolan-3-amine |
| SMILES | C=C(NC1CCS(=O)(=O)C1)C(C)C |
| InChI | InChI=1S/C9H17NO2S/c1-7(2)8(3)10-9-4-5-13(11,12)6-9/h7,9-10H,3-6H2,1-2H3 |
| InChIKey | KAKDNDQYVCJHPO-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.31 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |