C6H12N2O2S2 — CID 7178311
1-[(3S)-1,1-dioxothiolan-3-yl]-3-methylthiourea (PubChem CID 7178311) has the molecular formula C6H12N2O2S2 and a molecular weight of 208.31 g/mol. Its IUPAC name is 1-[(3S)-1,1-dioxothiolan-3-yl]-3-methylthiourea.
| Compound Name | 1-[(3S)-1,1-dioxothiolan-3-yl]-3-methylthiourea |
|---|---|
| PubChem CID | 7178311 |
| Molecular Formula | C6H12N2O2S2 |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.03 |
| IUPAC Name | 1-[(3S)-1,1-dioxothiolan-3-yl]-3-methylthiourea |
| SMILES | CNC(=S)N[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C6H12N2O2S2/c1-7-6(11)8-5-2-3-12(9,10)4-5/h5H,2-4H2,1H3,(H2,7,8,11)/t5-/m0/s1 |
| InChIKey | KRZLCYJWWYBRGK-YFKPBYRVSA-N |
| XLogP | -0.73 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|