C9H18N2O4S2 — CID 40549359
3-[(3S)-1,1-dioxothiolan-3-yl]-1,1-bis(2-hydroxyethyl)thiourea (PubChem CID 40549359) has the molecular formula C9H18N2O4S2 and a molecular weight of 282.39 g/mol. Its IUPAC name is 3-[(3S)-1,1-dioxothiolan-3-yl]-1,1-bis(2-hydroxyethyl)thiourea.
| Compound Name | 3-[(3S)-1,1-dioxothiolan-3-yl]-1,1-bis(2-hydroxyethyl)thiourea |
|---|---|
| PubChem CID | 40549359 |
| Molecular Formula | C9H18N2O4S2 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 3-[(3S)-1,1-dioxothiolan-3-yl]-1,1-bis(2-hydroxyethyl)thiourea |
| SMILES | O=S1(=O)CC[C@H](NC(=S)N(CCO)CCO)C1 |
| InChI | InChI=1S/C9H18N2O4S2/c12-4-2-11(3-5-13)9(16)10-8-1-6-17(14,15)7-8/h8,12-13H,1-7H2,(H,10,16)/t8-/m0/s1 |
| InChIKey | AHZZGCOWDRPINU-QMMMGPOBSA-N |
| XLogP | -1.67 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|