C9H17N3O4S3 — CID 40603718
1-[(3R)-1,1-dioxothiolan-3-yl]-3-[[(3S)-1,1-dioxothiolan-3-yl]amino]thiourea (PubChem CID 40603718) has the molecular formula C9H17N3O4S3 and a molecular weight of 327.45 g/mol. Its IUPAC name is 1-[(3R)-1,1-dioxothiolan-3-yl]-3-[[(3S)-1,1-dioxothiolan-3-yl]amino]thiourea.
| Compound Name | 1-[(3R)-1,1-dioxothiolan-3-yl]-3-[[(3S)-1,1-dioxothiolan-3-yl]amino]thiourea |
|---|---|
| PubChem CID | 40603718 |
| Molecular Formula | C9H17N3O4S3 |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.04 |
| IUPAC Name | 1-[(3R)-1,1-dioxothiolan-3-yl]-3-[[(3S)-1,1-dioxothiolan-3-yl]amino]thiourea |
| SMILES | O=S1(=O)CC[C@H](NNC(=S)N[C@@H]2CCS(=O)(=O)C2)C1 |
| InChI | InChI=1S/C9H17N3O4S3/c13-18(14)3-1-7(5-18)10-9(17)12-11-8-2-4-19(15,16)6-8/h7-8,11H,1-6H2,(H2,10,12,17)/t7-,8+/m1/s1 |
| InChIKey | VDNOSIVUSRWVGX-SFYZADRCSA-N |
| XLogP | -1.67 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|