C9H14N2O4S — CID 108526860
N-cyclopropyl-N'-(1,1-dioxothiolan-3-yl)oxamide (PubChem CID 108526860) has the molecular formula C9H14N2O4S and a molecular weight of 246.29 g/mol. Its IUPAC name is N-cyclopropyl-N'-(1,1-dioxothiolan-3-yl)oxamide.
| Compound Name | N-cyclopropyl-N'-(1,1-dioxothiolan-3-yl)oxamide |
|---|---|
| PubChem CID | 108526860 |
| Molecular Formula | C9H14N2O4S |
| Molecular Weight | 246.29 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | N-cyclopropyl-N'-(1,1-dioxothiolan-3-yl)oxamide |
| SMILES | O=C(NC1CC1)C(=O)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H14N2O4S/c12-8(10-6-1-2-6)9(13)11-7-3-4-16(14,15)5-7/h6-7H,1-5H2,(H,10,12)(H,11,13) |
| InChIKey | FFWOMECADBTLPG-UHFFFAOYSA-N |
| XLogP | -1.43 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.29 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|