C8H13NO3S — CID 3806585
N-(1,1-dioxothiolan-3-yl)-2-methylprop-2-enamide (PubChem CID 3806585) has the molecular formula C8H13NO3S and a molecular weight of 203.26 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-2-methylprop-2-enamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 3806585 |
| Molecular Formula | C8H13NO3S |
| Molecular Weight | 203.26 g/mol |
| Exact Mass | 203.06 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C8H13NO3S/c1-6(2)8(10)9-7-3-4-13(11,12)5-7/h7H,1,3-5H2,2H3,(H,9,10) |
| InChIKey | DOBQQFWGWLXMDI-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.26 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|