C13H22N2O4S — CID 108524869
2-(2,6-dimethylpiperidin-1-yl)-N-(1,1-dioxothiolan-3-yl)-2-oxoacetamide (PubChem CID 108524869) has the molecular formula C13H22N2O4S and a molecular weight of 302.40 g/mol. Its IUPAC name is 2-(2,6-dimethylpiperidin-1-yl)-N-(1,1-dioxothiolan-3-yl)-2-oxoacetamide.
| Compound Name | 2-(2,6-dimethylpiperidin-1-yl)-N-(1,1-dioxothiolan-3-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 108524869 |
| Molecular Formula | C13H22N2O4S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 2-(2,6-dimethylpiperidin-1-yl)-N-(1,1-dioxothiolan-3-yl)-2-oxoacetamide |
| SMILES | CC1CCCC(C)N1C(=O)C(=O)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H22N2O4S/c1-9-4-3-5-10(2)15(9)13(17)12(16)14-11-6-7-20(18,19)8-11/h9-11H,3-8H2,1-2H3,(H,14,16) |
| InChIKey | FXQGQGIYRSMDDT-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|