C6H10INO3S — CID 9196310
N-[(3S)-1,1-dioxothiolan-3-yl]-2-iodoacetamide (PubChem CID 9196310) has the molecular formula C6H10INO3S and a molecular weight of 303.12 g/mol. Its IUPAC name is N-[(3S)-1,1-dioxothiolan-3-yl]-2-iodoacetamide.
| Compound Name | N-[(3S)-1,1-dioxothiolan-3-yl]-2-iodoacetamide |
|---|---|
| PubChem CID | 9196310 |
| Molecular Formula | C6H10INO3S |
| Molecular Weight | 303.12 g/mol |
| Exact Mass | 302.94 |
| IUPAC Name | N-[(3S)-1,1-dioxothiolan-3-yl]-2-iodoacetamide |
| SMILES | O=C(CI)N[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C6H10INO3S/c7-3-6(9)8-5-1-2-12(10,11)4-5/h5H,1-4H2,(H,8,9)/t5-/m0/s1 |
| InChIKey | OUECFDAOLKIWTR-YFKPBYRVSA-N |
| XLogP | -0.28 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.12 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|