C10H19N3O5S2 — CID 18801502
N-(1,1-dioxothiolan-3-yl)-2-[2-(1,1-dioxothiolan-3-yl)hydrazinyl]acetamide (PubChem CID 18801502) has the molecular formula C10H19N3O5S2 and a molecular weight of 325.41 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-2-[2-(1,1-dioxothiolan-3-yl)hydrazinyl]acetamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-2-[2-(1,1-dioxothiolan-3-yl)hydrazinyl]acetamide |
|---|---|
| PubChem CID | 18801502 |
| Molecular Formula | C10H19N3O5S2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-2-[2-(1,1-dioxothiolan-3-yl)hydrazinyl]acetamide |
| SMILES | O=C(CNNC1CCS(=O)(=O)C1)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H19N3O5S2/c14-10(12-8-1-3-19(15,16)6-8)5-11-13-9-2-4-20(17,18)7-9/h8-9,11,13H,1-7H2,(H,12,14) |
| InChIKey | RLVWSNANNNULTM-UHFFFAOYSA-N |
| XLogP | -2.43 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | -2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|