C11H19NO5S2 — CID 110852811
2-(1,1-dioxothian-4-yl)-N-(1,1-dioxothiolan-3-yl)acetamide (PubChem CID 110852811) has the molecular formula C11H19NO5S2 and a molecular weight of 309.41 g/mol. Its IUPAC name is 2-(1,1-dioxothian-4-yl)-N-(1,1-dioxothiolan-3-yl)acetamide.
| Compound Name | 2-(1,1-dioxothian-4-yl)-N-(1,1-dioxothiolan-3-yl)acetamide |
|---|---|
| PubChem CID | 110852811 |
| Molecular Formula | C11H19NO5S2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 2-(1,1-dioxothian-4-yl)-N-(1,1-dioxothiolan-3-yl)acetamide |
| SMILES | O=C(CC1CCS(=O)(=O)CC1)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H19NO5S2/c13-11(12-10-3-6-19(16,17)8-10)7-9-1-4-18(14,15)5-2-9/h9-10H,1-8H2,(H,12,13) |
| InChIKey | GVUMRXDUNMWPJT-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 97.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |