C12H22N2O3S — CID 43179464
N-cyclohexyl-2-[(1,1-dioxothiolan-3-yl)amino]acetamide (PubChem CID 43179464) has the molecular formula C12H22N2O3S and a molecular weight of 274.39 g/mol. Its IUPAC name is N-cyclohexyl-2-[(1,1-dioxothiolan-3-yl)amino]acetamide.
| Compound Name | N-cyclohexyl-2-[(1,1-dioxothiolan-3-yl)amino]acetamide |
|---|---|
| PubChem CID | 43179464 |
| Molecular Formula | C12H22N2O3S |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | N-cyclohexyl-2-[(1,1-dioxothiolan-3-yl)amino]acetamide |
| SMILES | O=C(CNC1CCS(=O)(=O)C1)NC1CCCCC1 |
| InChI | InChI=1S/C12H22N2O3S/c15-12(14-10-4-2-1-3-5-10)8-13-11-6-7-18(16,17)9-11/h10-11,13H,1-9H2,(H,14,15) |
| InChIKey | PGEREPBAFSRYGT-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |