C13H24N2O4S3 — CID 4521203
1-butyl-1,3-bis(1,1-dioxothiolan-3-yl)thiourea (PubChem CID 4521203) has the molecular formula C13H24N2O4S3 and a molecular weight of 368.55 g/mol. Its IUPAC name is 1-butyl-1,3-bis(1,1-dioxothiolan-3-yl)thiourea.
| Compound Name | 1-butyl-1,3-bis(1,1-dioxothiolan-3-yl)thiourea |
|---|---|
| PubChem CID | 4521203 |
| Molecular Formula | C13H24N2O4S3 |
| Molecular Weight | 368.55 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | 1-butyl-1,3-bis(1,1-dioxothiolan-3-yl)thiourea |
| SMILES | CCCCN(C(=S)NC1CCS(=O)(=O)C1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H24N2O4S3/c1-2-3-6-15(12-5-8-22(18,19)10-12)13(20)14-11-4-7-21(16,17)9-11/h11-12H,2-10H2,1H3,(H,14,20) |
| InChIKey | UDPRMPBIDZPJEO-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.55 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|