C14H24N2O5S3 — CID 3788612
1,3-bis(1,1-dioxothiolan-3-yl)-1-(oxolan-2-ylmethyl)thiourea (PubChem CID 3788612) has the molecular formula C14H24N2O5S3 and a molecular weight of 396.56 g/mol. Its IUPAC name is 1,3-bis(1,1-dioxothiolan-3-yl)-1-(oxolan-2-ylmethyl)thiourea.
| Compound Name | 1,3-bis(1,1-dioxothiolan-3-yl)-1-(oxolan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 3788612 |
| Molecular Formula | C14H24N2O5S3 |
| Molecular Weight | 396.56 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | 1,3-bis(1,1-dioxothiolan-3-yl)-1-(oxolan-2-ylmethyl)thiourea |
| SMILES | O=S1(=O)CCC(NC(=S)N(CC2CCCO2)C2CCS(=O)(=O)C2)C1 |
| InChI | InChI=1S/C14H24N2O5S3/c17-23(18)6-3-11(9-23)15-14(22)16(8-13-2-1-5-21-13)12-4-7-24(19,20)10-12/h11-13H,1-10H2,(H,15,22) |
| InChIKey | YKGFCQJRBLHZHN-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.56 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|