C17H23ClN2O3S2 — CID 8769759
3-(3-chloro-4-methylphenyl)-1-[(3R)-1,1-dioxothiolan-3-yl]-1-[[(2R)-oxolan-2-yl]methyl]thiourea (PubChem CID 8769759) has the molecular formula C17H23ClN2O3S2 and a molecular weight of 402.97 g/mol. Its IUPAC name is 3-(3-chloro-4-methylphenyl)-1-[(3R)-1,1-dioxothiolan-3-yl]-1-[[(2R)-oxolan-2-yl]methyl]thiourea.
| Compound Name | 3-(3-chloro-4-methylphenyl)-1-[(3R)-1,1-dioxothiolan-3-yl]-1-[[(2R)-oxolan-2-yl]methyl]thiourea |
|---|---|
| PubChem CID | 8769759 |
| Molecular Formula | C17H23ClN2O3S2 |
| Molecular Weight | 402.97 g/mol |
| Exact Mass | 402.08 |
| IUPAC Name | 3-(3-chloro-4-methylphenyl)-1-[(3R)-1,1-dioxothiolan-3-yl]-1-[[(2R)-oxolan-2-yl]methyl]thiourea |
| SMILES | Cc1ccc(NC(=S)N(C[C@H]2CCCO2)[C@@H]2CCS(=O)(=O)C2)cc1Cl |
| InChI | InChI=1S/C17H23ClN2O3S2/c1-12-4-5-13(9-16(12)18)19-17(24)20(10-15-3-2-7-23-15)14-6-8-25(21,22)11-14/h4-5,9,14-15H,2-3,6-8,10-11H2,1H3,(H,19,24)/t14-,15-/m1/s1 |
| InChIKey | KWLYESVDCIBIAC-HUUCEWRRSA-N |
| XLogP | 3.01 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.97 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|