C18H23ClN2O6S — CID 18204404
[2-[(1,1-dioxothiolan-3-yl)-(oxolan-2-ylmethyl)amino]-2-oxoethyl] 3-amino-4-chlorobenzoate (PubChem CID 18204404) has the molecular formula C18H23ClN2O6S and a molecular weight of 430.91 g/mol. Its IUPAC name is [2-[(1,1-dioxothiolan-3-yl)-(oxolan-2-ylmethyl)amino]-2-oxoethyl] 3-amino-4-chlorobenzoate.
| Compound Name | [2-[(1,1-dioxothiolan-3-yl)-(oxolan-2-ylmethyl)amino]-2-oxoethyl] 3-amino-4-chlorobenzoate |
|---|---|
| PubChem CID | 18204404 |
| Molecular Formula | C18H23ClN2O6S |
| Molecular Weight | 430.91 g/mol |
| Exact Mass | 430.10 |
| IUPAC Name | [2-[(1,1-dioxothiolan-3-yl)-(oxolan-2-ylmethyl)amino]-2-oxoethyl] 3-amino-4-chlorobenzoate |
| SMILES | Nc1cc(C(=O)OCC(=O)N(CC2CCCO2)C2CCS(=O)(=O)C2)ccc1Cl |
| InChI | InChI=1S/C18H23ClN2O6S/c19-15-4-3-12(8-16(15)20)18(23)27-10-17(22)21(9-14-2-1-6-26-14)13-5-7-28(24,25)11-13/h3-4,8,13-14H,1-2,5-7,9-11,20H2 |
| InChIKey | OBHSNKGNWRDXES-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 116.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.91 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|