C17H21ClN2O7S — CID 46790068
[2-[butyl-(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 4-chloro-3-nitrobenzoate (PubChem CID 46790068) has the molecular formula C17H21ClN2O7S and a molecular weight of 432.88 g/mol. Its IUPAC name is [2-[butyl-(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 4-chloro-3-nitrobenzoate.
| Compound Name | [2-[butyl-(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 4-chloro-3-nitrobenzoate |
|---|---|
| PubChem CID | 46790068 |
| Molecular Formula | C17H21ClN2O7S |
| Molecular Weight | 432.88 g/mol |
| Exact Mass | 432.08 |
| IUPAC Name | [2-[butyl-(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 4-chloro-3-nitrobenzoate |
| SMILES | CCCCN(C(=O)COC(=O)c1ccc(Cl)c([N+](=O)[O-])c1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H21ClN2O7S/c1-2-3-7-19(13-6-8-28(25,26)11-13)16(21)10-27-17(22)12-4-5-14(18)15(9-12)20(23)24/h4-5,9,13H,2-3,6-8,10-11H2,1H3 |
| InChIKey | XYEZQPZXROVLBO-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 123.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.88 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|