C21H29N3O7S — CID 51466242
[2-[[(3R)-1,1-dioxothiolan-3-yl]-ethylamino]-2-oxoethyl] 4-[(3S)-3-methylpiperidin-1-yl]-3-nitrobenzoate (PubChem CID 51466242) has the molecular formula C21H29N3O7S and a molecular weight of 467.54 g/mol. Its IUPAC name is [2-[[(3R)-1,1-dioxothiolan-3-yl]-ethylamino]-2-oxoethyl] 4-[(3S)-3-methylpiperidin-1-yl]-3-nitrobenzoate.
| Compound Name | [2-[[(3R)-1,1-dioxothiolan-3-yl]-ethylamino]-2-oxoethyl] 4-[(3S)-3-methylpiperidin-1-yl]-3-nitrobenzoate |
|---|---|
| PubChem CID | 51466242 |
| Molecular Formula | C21H29N3O7S |
| Molecular Weight | 467.54 g/mol |
| Exact Mass | 467.17 |
| IUPAC Name | [2-[[(3R)-1,1-dioxothiolan-3-yl]-ethylamino]-2-oxoethyl] 4-[(3S)-3-methylpiperidin-1-yl]-3-nitrobenzoate |
| SMILES | CCN(C(=O)COC(=O)c1ccc(N2CCC[C@H](C)C2)c([N+](=O)[O-])c1)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C21H29N3O7S/c1-3-23(17-8-10-32(29,30)14-17)20(25)13-31-21(26)16-6-7-18(19(11-16)24(27)28)22-9-4-5-15(2)12-22/h6-7,11,15,17H,3-5,8-10,12-14H2,1-2H3/t15-,17+/m0/s1 |
| InChIKey | CVMUBYRYKNFDIR-DOTOQJQBSA-N |
| XLogP | 2.02 |
| TPSA | 127.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.54 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|