C21H29N3O8S — CID 4840220
[2-[butan-2-yl-(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 4-morpholin-4-yl-3-nitrobenzoate (PubChem CID 4840220) has the molecular formula C21H29N3O8S and a molecular weight of 483.54 g/mol. Its IUPAC name is [2-[butan-2-yl-(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 4-morpholin-4-yl-3-nitrobenzoate.
| Compound Name | [2-[butan-2-yl-(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 4-morpholin-4-yl-3-nitrobenzoate |
|---|---|
| PubChem CID | 4840220 |
| Molecular Formula | C21H29N3O8S |
| Molecular Weight | 483.54 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | [2-[butan-2-yl-(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 4-morpholin-4-yl-3-nitrobenzoate |
| SMILES | CCC(C)N(C(=O)COC(=O)c1ccc(N2CCOCC2)c([N+](=O)[O-])c1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C21H29N3O8S/c1-3-15(2)23(17-6-11-33(29,30)14-17)20(25)13-32-21(26)16-4-5-18(19(12-16)24(27)28)22-7-9-31-10-8-22/h4-5,12,15,17H,3,6-11,13-14H2,1-2H3 |
| InChIKey | HQFWUOOOGFNNLE-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 136.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.54 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|