C18H24N2O7S — CID 8709974
[2-[[(2S)-butan-2-yl]-[(3S)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] 2-methyl-3-nitrobenzoate (PubChem CID 8709974) has the molecular formula C18H24N2O7S and a molecular weight of 412.46 g/mol. Its IUPAC name is [2-[[(2S)-butan-2-yl]-[(3S)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] 2-methyl-3-nitrobenzoate.
| Compound Name | [2-[[(2S)-butan-2-yl]-[(3S)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] 2-methyl-3-nitrobenzoate |
|---|---|
| PubChem CID | 8709974 |
| Molecular Formula | C18H24N2O7S |
| Molecular Weight | 412.46 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | [2-[[(2S)-butan-2-yl]-[(3S)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] 2-methyl-3-nitrobenzoate |
| SMILES | CC[C@H](C)N(C(=O)COC(=O)c1cccc([N+](=O)[O-])c1C)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C18H24N2O7S/c1-4-12(2)19(14-8-9-28(25,26)11-14)17(21)10-27-18(22)15-6-5-7-16(13(15)3)20(23)24/h5-7,12,14H,4,8-11H2,1-3H3/t12-,14-/m0/s1 |
| InChIKey | WYPVJQNKVQQLPZ-JSGCOSHPSA-N |
| XLogP | 1.87 |
| TPSA | 123.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.46 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|