C19H28N4O5S — CID 4830944
[2-[butan-2-yl-(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 2-(dimethylaminodiazenyl)benzoate (PubChem CID 4830944) has the molecular formula C19H28N4O5S and a molecular weight of 424.52 g/mol. Its IUPAC name is [2-[butan-2-yl-(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 2-(dimethylaminodiazenyl)benzoate.
| Compound Name | [2-[butan-2-yl-(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 2-(dimethylaminodiazenyl)benzoate |
|---|---|
| PubChem CID | 4830944 |
| Molecular Formula | C19H28N4O5S |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | [2-[butan-2-yl-(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 2-(dimethylaminodiazenyl)benzoate |
| SMILES | CCC(C)N(C(=O)COC(=O)c1ccccc1/N=N/N(C)C)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C19H28N4O5S/c1-5-14(2)23(15-10-11-29(26,27)13-15)18(24)12-28-19(25)16-8-6-7-9-17(16)20-21-22(3)4/h6-9,14-15H,5,10-13H2,1-4H3/b21-20+ |
| InChIKey | CAQKIAUPCAWNSQ-QZQOTICOSA-N |
| XLogP | 2.22 |
| TPSA | 108.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|