C18H24N2O7S2 — CID 41030572
[2-[[(2S)-butan-2-yl]-[(3R)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] 2-(4-nitrophenyl)sulfanylacetate (PubChem CID 41030572) has the molecular formula C18H24N2O7S2 and a molecular weight of 444.53 g/mol. Its IUPAC name is [2-[[(2S)-butan-2-yl]-[(3R)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] 2-(4-nitrophenyl)sulfanylacetate.
| Compound Name | [2-[[(2S)-butan-2-yl]-[(3R)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] 2-(4-nitrophenyl)sulfanylacetate |
|---|---|
| PubChem CID | 41030572 |
| Molecular Formula | C18H24N2O7S2 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.10 |
| IUPAC Name | [2-[[(2S)-butan-2-yl]-[(3R)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] 2-(4-nitrophenyl)sulfanylacetate |
| SMILES | CC[C@H](C)N(C(=O)COC(=O)CSc1ccc([N+](=O)[O-])cc1)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C18H24N2O7S2/c1-3-13(2)19(15-8-9-29(25,26)12-15)17(21)10-27-18(22)11-28-16-6-4-14(5-7-16)20(23)24/h4-7,13,15H,3,8-12H2,1-2H3/t13-,15+/m0/s1 |
| InChIKey | YKCJNIKIAAUQHL-DZGCQCFKSA-N |
| XLogP | 2.04 |
| TPSA | 123.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|