C16H20N2O7S2 — CID 41030562
[2-[[(3S)-1,1-dioxothiolan-3-yl]-ethylamino]-2-oxoethyl] 2-(4-nitrophenyl)sulfanylacetate (PubChem CID 41030562) has the molecular formula C16H20N2O7S2 and a molecular weight of 416.48 g/mol. Its IUPAC name is [2-[[(3S)-1,1-dioxothiolan-3-yl]-ethylamino]-2-oxoethyl] 2-(4-nitrophenyl)sulfanylacetate.
| Compound Name | [2-[[(3S)-1,1-dioxothiolan-3-yl]-ethylamino]-2-oxoethyl] 2-(4-nitrophenyl)sulfanylacetate |
|---|---|
| PubChem CID | 41030562 |
| Molecular Formula | C16H20N2O7S2 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.07 |
| IUPAC Name | [2-[[(3S)-1,1-dioxothiolan-3-yl]-ethylamino]-2-oxoethyl] 2-(4-nitrophenyl)sulfanylacetate |
| SMILES | CCN(C(=O)COC(=O)CSc1ccc([N+](=O)[O-])cc1)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H20N2O7S2/c1-2-17(13-7-8-27(23,24)11-13)15(19)9-25-16(20)10-26-14-5-3-12(4-6-14)18(21)22/h3-6,13H,2,7-11H2,1H3/t13-/m0/s1 |
| InChIKey | IIIFMWHKJGPPDI-ZDUSSCGKSA-N |
| XLogP | 1.27 |
| TPSA | 123.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|