C19H23ClN2O7S — CID 55318945
[2-[cyclohexyl-(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 4-chloro-3-nitrobenzoate (PubChem CID 55318945) has the molecular formula C19H23ClN2O7S and a molecular weight of 458.92 g/mol. Its IUPAC name is [2-[cyclohexyl-(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 4-chloro-3-nitrobenzoate.
| Compound Name | [2-[cyclohexyl-(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 4-chloro-3-nitrobenzoate |
|---|---|
| PubChem CID | 55318945 |
| Molecular Formula | C19H23ClN2O7S |
| Molecular Weight | 458.92 g/mol |
| Exact Mass | 458.09 |
| IUPAC Name | [2-[cyclohexyl-(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 4-chloro-3-nitrobenzoate |
| SMILES | O=C(OCC(=O)N(C1CCCCC1)C1CCS(=O)(=O)C1)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H23ClN2O7S/c20-16-7-6-13(10-17(16)22(25)26)19(24)29-11-18(23)21(14-4-2-1-3-5-14)15-8-9-30(27,28)12-15/h6-7,10,14-15H,1-5,8-9,11-12H2 |
| InChIKey | QKVGWOXFEUUBJK-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 123.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.92 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|