C18H22N2O7S — CID 9412155
[2-[cyclopentyl-[(3S)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] 2-nitrobenzoate (PubChem CID 9412155) has the molecular formula C18H22N2O7S and a molecular weight of 410.45 g/mol. Its IUPAC name is [2-[cyclopentyl-[(3S)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] 2-nitrobenzoate.
| Compound Name | [2-[cyclopentyl-[(3S)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] 2-nitrobenzoate |
|---|---|
| PubChem CID | 9412155 |
| Molecular Formula | C18H22N2O7S |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | [2-[cyclopentyl-[(3S)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] 2-nitrobenzoate |
| SMILES | O=C(OCC(=O)N(C1CCCC1)[C@H]1CCS(=O)(=O)C1)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H22N2O7S/c21-17(11-27-18(22)15-7-3-4-8-16(15)20(23)24)19(13-5-1-2-6-13)14-9-10-28(25,26)12-14/h3-4,7-8,13-14H,1-2,5-6,9-12H2/t14-/m0/s1 |
| InChIKey | ONJWQNVPNZKKQG-AWEZNQCLSA-N |
| XLogP | 1.71 |
| TPSA | 123.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|