C26H31NO5S — CID 41306041
[2-[cyclohexyl-[(3S)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] 2-benzylbenzoate (PubChem CID 41306041) has the molecular formula C26H31NO5S and a molecular weight of 469.60 g/mol. Its IUPAC name is [2-[cyclohexyl-[(3S)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] 2-benzylbenzoate.
| Compound Name | [2-[cyclohexyl-[(3S)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] 2-benzylbenzoate |
|---|---|
| PubChem CID | 41306041 |
| Molecular Formula | C26H31NO5S |
| Molecular Weight | 469.60 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | [2-[cyclohexyl-[(3S)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] 2-benzylbenzoate |
| SMILES | O=C(OCC(=O)N(C1CCCCC1)[C@H]1CCS(=O)(=O)C1)c1ccccc1Cc1ccccc1 |
| InChI | InChI=1S/C26H31NO5S/c28-25(27(22-12-5-2-6-13-22)23-15-16-33(30,31)19-23)18-32-26(29)24-14-8-7-11-21(24)17-20-9-3-1-4-10-20/h1,3-4,7-11,14,22-23H,2,5-6,12-13,15-19H2/t23-/m0/s1 |
| InChIKey | XKYYFTKZSIJEFS-QHCPKHFHSA-N |
| XLogP | 3.78 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.60 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |