C23H34N2O5S — CID 42898704
[2-[cyclohexyl-(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 2-(butylamino)benzoate (PubChem CID 42898704) has the molecular formula C23H34N2O5S and a molecular weight of 450.60 g/mol. Its IUPAC name is [2-[cyclohexyl-(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 2-(butylamino)benzoate.
| Compound Name | [2-[cyclohexyl-(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 2-(butylamino)benzoate |
|---|---|
| PubChem CID | 42898704 |
| Molecular Formula | C23H34N2O5S |
| Molecular Weight | 450.60 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | [2-[cyclohexyl-(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 2-(butylamino)benzoate |
| SMILES | CCCCNc1ccccc1C(=O)OCC(=O)N(C1CCCCC1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C23H34N2O5S/c1-2-3-14-24-21-12-8-7-11-20(21)23(27)30-16-22(26)25(18-9-5-4-6-10-18)19-13-15-31(28,29)17-19/h7-8,11-12,18-19,24H,2-6,9-10,13-17H2,1H3 |
| InChIKey | CCRBZPKSDGCPPK-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.60 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|