C18H26N2O4S2 — CID 8769817
1-[(3S)-1,1-dioxothiolan-3-yl]-3-[(4-methoxyphenyl)methyl]-1-[[(2R)-oxolan-2-yl]methyl]thiourea (PubChem CID 8769817) has the molecular formula C18H26N2O4S2 and a molecular weight of 398.55 g/mol. Its IUPAC name is 1-[(3S)-1,1-dioxothiolan-3-yl]-3-[(4-methoxyphenyl)methyl]-1-[[(2R)-oxolan-2-yl]methyl]thiourea.
| Compound Name | 1-[(3S)-1,1-dioxothiolan-3-yl]-3-[(4-methoxyphenyl)methyl]-1-[[(2R)-oxolan-2-yl]methyl]thiourea |
|---|---|
| PubChem CID | 8769817 |
| Molecular Formula | C18H26N2O4S2 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | 1-[(3S)-1,1-dioxothiolan-3-yl]-3-[(4-methoxyphenyl)methyl]-1-[[(2R)-oxolan-2-yl]methyl]thiourea |
| SMILES | COc1ccc(CNC(=S)N(C[C@H]2CCCO2)[C@H]2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C18H26N2O4S2/c1-23-16-6-4-14(5-7-16)11-19-18(25)20(12-17-3-2-9-24-17)15-8-10-26(21,22)13-15/h4-7,15,17H,2-3,8-13H2,1H3,(H,19,25)/t15-,17+/m0/s1 |
| InChIKey | MSQWHIATQOPBSF-DOTOQJQBSA-N |
| XLogP | 1.74 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|