C18H26N2O3S2 — CID 8680751
3-(3,4-dimethylphenyl)-1-[(3R)-1,1-dioxothiolan-3-yl]-1-[[(2S)-oxolan-2-yl]methyl]thiourea (PubChem CID 8680751) has the molecular formula C18H26N2O3S2 and a molecular weight of 382.55 g/mol. Its IUPAC name is 3-(3,4-dimethylphenyl)-1-[(3R)-1,1-dioxothiolan-3-yl]-1-[[(2S)-oxolan-2-yl]methyl]thiourea.
| Compound Name | 3-(3,4-dimethylphenyl)-1-[(3R)-1,1-dioxothiolan-3-yl]-1-[[(2S)-oxolan-2-yl]methyl]thiourea |
|---|---|
| PubChem CID | 8680751 |
| Molecular Formula | C18H26N2O3S2 |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 3-(3,4-dimethylphenyl)-1-[(3R)-1,1-dioxothiolan-3-yl]-1-[[(2S)-oxolan-2-yl]methyl]thiourea |
| SMILES | Cc1ccc(NC(=S)N(C[C@@H]2CCCO2)[C@@H]2CCS(=O)(=O)C2)cc1C |
| InChI | InChI=1S/C18H26N2O3S2/c1-13-5-6-15(10-14(13)2)19-18(24)20(11-17-4-3-8-23-17)16-7-9-25(21,22)12-16/h5-6,10,16-17H,3-4,7-9,11-12H2,1-2H3,(H,19,24)/t16-,17+/m1/s1 |
| InChIKey | ZSQZAHHKKLCJRR-SJORKVTESA-N |
| XLogP | 2.67 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|